The chemical compound "UO2(2+)*C28H22N2O2S2(2-)=UO2(C28H22N2O2S2)" represents a complex between uranium dioxide (UO2(2+)) and a large organic ligand, which is a dianionic species with the formula C28H22N2O2S2(2-). This complex is formed through coordination, where the uranium dioxide acts as a central metal ion and the organic ligand surrounds it, forming a coordination complex. The organic ligand, with its two sulfur atoms, likely binds to the uranium ion through sulfur donor atoms, creating a stable complex. This type of complex is of interest in the field of inorganic chemistry, particularly in the study of coordination compounds and their applications in areas such as nuclear chemistry, catalysis, and materials science.
The CAS Registry Mumber 36077-61-9 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 3,6,0,7 and 7 respectively; the second part has 2 digits, 6 and 1 respectively. Calculate Digit Verification of CAS Registry Number 36077-61: (7*3)+(6*6)+(5*0)+(4*7)+(3*7)+(2*6)+(1*1)=119 119 % 10 = 9 So 36077-61-9 is a valid CAS Registry Number.