3613-80-7 Usage
Uses
Used in Pharmaceutical Industry:
4,5-Bis(mercaptomethyl)-2-methyl-3-pyridinol is used as a complexing agent for metal ions, particularly in the development of potential antidotes for heavy metal poisoning. Its ability to bind with metal ions aids in mitigating the toxic effects of heavy metals in the body.
Used in Industrial Processes:
In industrial applications, 4,5-Bis(mercaptomethyl)-2-methyl-3-pyridinol serves as a chelating agent to facilitate processes that involve metal ion management, such as in the manufacturing of certain chemicals or materials where metal ion control is crucial for product quality and consistency.
Used in Research Laboratories:
4,5-Bis(mercaptomethyl)-2-methyl-3-pyridinol is utilized in the synthesis of coordination compounds for research purposes. Its chelating properties are harnessed in the creation of new chemical compounds and in studying the interactions between metal ions and organic molecules, which is vital for advancing knowledge in chemistry and biochemistry.
Check Digit Verification of cas no
The CAS Registry Mumber 3613-80-7 includes 7 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 4 digits, 3,6,1 and 3 respectively; the second part has 2 digits, 8 and 0 respectively.
Calculate Digit Verification of CAS Registry Number 3613-80:
(6*3)+(5*6)+(4*1)+(3*3)+(2*8)+(1*0)=77
77 % 10 = 7
So 3613-80-7 is a valid CAS Registry Number.
InChI:InChI=1/C8H11NOS2/c1-5-8(10)7(4-12)6(3-11)2-9-5/h2,10-12H,3-4H2,1H3
