361344-43-6 Usage
Uses
Used in Pharmaceutical Development:
4-Morpholinophenylglyoxal is used as a key intermediate in the synthesis of various pharmaceutical compounds. Its unique structure allows for the creation of new drugs with potential therapeutic applications, contributing to the advancement of medicine.
Used in Agrochemical Production:
In the agrochemical industry, 4-Morpholinophenylglyoxal is employed as a building block for the development of novel agrochemicals. Its incorporation into these compounds can lead to improved pest control and crop protection, enhancing agricultural productivity.
Used in Materials Science:
4-Morpholinophenylglyoxal is utilized in materials science for the synthesis of new materials with unique properties. Its versatility allows for the development of materials with potential applications in various fields, such as electronics, energy storage, and advanced manufacturing.
Used in Heterocyclic Compound Preparation:
As a valuable building block, 4-Morpholinophenylglyoxal is used in the preparation of heterocyclic compounds. These compounds are important in various chemical and pharmaceutical applications, and the use of 4-Morpholinophenylglyoxal can lead to the discovery of new heterocyclic compounds with diverse properties and applications.
Check Digit Verification of cas no
The CAS Registry Mumber 361344-43-6 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 3,6,1,3,4 and 4 respectively; the second part has 2 digits, 4 and 3 respectively.
Calculate Digit Verification of CAS Registry Number 361344-43:
(8*3)+(7*6)+(6*1)+(5*3)+(4*4)+(3*4)+(2*4)+(1*3)=126
126 % 10 = 6
So 361344-43-6 is a valid CAS Registry Number.
InChI:InChI=1/C12H13NO3/c14-9-12(15)10-1-3-11(4-2-10)13-5-7-16-8-6-13/h1-4,9H,5-8H2
