36258-82-9 Usage
Uses
Used in Medicinal Chemistry and Drug Discovery:
4-Chloro-3H-[1,2,3]triazolo[4,5-c]pyridine is used as a building block for the synthesis of novel pharmaceuticals, given its potential antimicrobial, antifungal, or antiparasitic properties. It contributes to the development of new drugs by providing a structural foundation that can be modified to enhance therapeutic effects and target specific biological pathways.
Used in Chemical Research:
In the field of chemical research, 4-Chloro-3H-[1,2,3]triazolo[4,5-c]pyridine serves as a starting material for the synthesis of other organic compounds. Its unique structure allows for further chemical modifications and exploration of its reactivity, which can lead to the discovery of new chemical entities with diverse applications.
Used in Pharmaceutical Industry:
4-Chloro-3H-[1,2,3]triazolo[4,5-c]pyridine is used as a precursor in the pharmaceutical industry for the development of new drugs. Its potential biological activities make it a valuable component in the creation of medications aimed at treating various diseases and conditions, particularly those related to infectious diseases.
Used in Synthesis of Organic Compounds:
4-Chloro-3H-[1,2,3]triazolo[4,5-c]pyridine is utilized as a starting material for the synthesis of other organic compounds in organic chemistry. Its versatile structure allows for the exploration of new synthetic pathways and the creation of compounds with potential applications in various fields, including materials science, agrochemicals, and specialty chemicals.
Check Digit Verification of cas no
The CAS Registry Mumber 36258-82-9 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 3,6,2,5 and 8 respectively; the second part has 2 digits, 8 and 2 respectively.
Calculate Digit Verification of CAS Registry Number 36258-82:
(7*3)+(6*6)+(5*2)+(4*5)+(3*8)+(2*8)+(1*2)=129
129 % 10 = 9
So 36258-82-9 is a valid CAS Registry Number.
InChI:InChI=1/C5H3ClN4/c6-5-4-3(1-2-7-5)8-10-9-4/h1-2H,(H,8,9,10)
