36283-09-7 Usage
Tetrazole family
1H-tetrazol-1-yl group
The compound belongs to the tetrazole family, which is a group of organic compounds containing a 5-membered ring with four nitrogen atoms and one hydrogen atom.
Thien-2-ylacrylic acid group
3-thien-2-ylacrylic acid moiety
The compound contains a thien-2-ylacrylic acid group, which is a 5-membered sulfur-containing heterocyclic ring fused to a 2-propen-1-oic acid group.
Medicinal chemistry applications
Potential pharmacological properties
The compound may have potential applications in the field of medicinal chemistry due to its unique structure and properties, which could be investigated for therapeutic effects.
Research interest
Reactivity and properties of derivatives
Researchers are interested in studying the reactivity and properties of tetrazole and thien-2-ylacrylic acid derivatives, as these compounds may exhibit unique chemical behaviors.
Scientific and industrial potential
Structure and properties
The compound's structure and properties make it an intriguing target for further study and potential applications in various scientific and industrial fields, such as pharmaceuticals, materials science, and chemical engineering.
Check Digit Verification of cas no
The CAS Registry Mumber 36283-09-7 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 3,6,2,8 and 3 respectively; the second part has 2 digits, 0 and 9 respectively.
Calculate Digit Verification of CAS Registry Number 36283-09:
(7*3)+(6*6)+(5*2)+(4*8)+(3*3)+(2*0)+(1*9)=117
117 % 10 = 7
So 36283-09-7 is a valid CAS Registry Number.
InChI:InChI=1/C14H10N4O2S/c19-14(20)12(9-11-7-4-8-21-11)18-13(15-16-17-18)10-5-2-1-3-6-10/h1-9H,(H,19,20)/p-1
