36288-19-4 Usage
Uses
Used in Chemical Synthesis:
3-Methoxychrysene is used as an intermediate in the synthesis of 3-Hydroxychrysene (H750055), a metabolite of Chrysene (C428000). This application is crucial for the production of various chemical compounds and substances that have potential applications in different industries.
Used in Pharmaceutical Industry:
In the pharmaceutical industry, 3-Methoxychrysene plays a significant role in the synthesis of compounds that can be used for medicinal purposes. The synthesized compounds may have potential therapeutic effects and contribute to the development of new drugs and treatments.
Used in Research and Development:
3-Methoxychrysene is also utilized in research and development for studying the properties and behavior of various chemical compounds. This knowledge can be applied to create new materials, improve existing products, and develop innovative solutions in various fields, including chemistry, biology, and materials science.
Check Digit Verification of cas no
The CAS Registry Mumber 36288-19-4 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 3,6,2,8 and 8 respectively; the second part has 2 digits, 1 and 9 respectively.
Calculate Digit Verification of CAS Registry Number 36288-19:
(7*3)+(6*6)+(5*2)+(4*8)+(3*8)+(2*1)+(1*9)=134
134 % 10 = 4
So 36288-19-4 is a valid CAS Registry Number.
InChI:InChI=1/C19H14O/c1-20-15-9-6-14-8-10-17-16-5-3-2-4-13(16)7-11-18(17)19(14)12-15/h2-12H,1H3
