3634-94-4 Usage
General Description
Didecyl glutarate is a chemical compound that is primarily used as a plasticizer and a lubricant in various industrial applications. It is derived from glutaric acid and didecyl alcohol, and its main function is to improve the flexibility, durability, and workability of polymers and resins. Didecyl glutarate is commonly used in the production of vinyl materials, adhesives, and coatings, where it helps to reduce brittleness and increase the overall performance and lifespan of the finished products. Additionally, it is known for its low volatility and good thermal stability, making it suitable for use in high-temperature applications. Overall, didecyl glutarate is a versatile chemical that plays a critical role in enhancing the properties of various industrial materials.
Check Digit Verification of cas no
The CAS Registry Mumber 3634-94-4 includes 7 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 4 digits, 3,6,3 and 4 respectively; the second part has 2 digits, 9 and 4 respectively.
Calculate Digit Verification of CAS Registry Number 3634-94:
(6*3)+(5*6)+(4*3)+(3*4)+(2*9)+(1*4)=94
94 % 10 = 4
So 3634-94-4 is a valid CAS Registry Number.
InChI:InChI=1/C25H48O4/c1-3-5-7-9-11-13-15-17-22-28-24(26)20-19-21-25(27)29-23-18-16-14-12-10-8-6-4-2/h3-23H2,1-2H3