364-71-6 Usage
Uses
Used in Dye Industry:
4-Fluoro-2-nitroaniline is used as a chemical intermediate for the synthesis of various dyes. Its unique molecular structure, containing both a nitro and an aniline group, contributes to the color and properties of the resulting dyes.
Used in Pharmaceutical Industry:
4-Fluoro-2-nitroaniline is used as a building block in the development of pharmaceutical compounds. Its presence in the molecular structure can influence the drug's activity, stability, and other properties, making it an important component in the synthesis of certain medications.
In both the dye and pharmaceutical industries, 4-fluoro-2-nitroaniline plays a crucial role in the production of various products. Its unique chemical properties and reactivity make it a valuable component in the synthesis of dyes and pharmaceuticals. However, due to its toxic nature, it is essential to handle 4-FLUORO-2-NITROANILINE with care and follow proper safety protocols to minimize potential health risks.
Check Digit Verification of cas no
The CAS Registry Mumber 364-71-6 includes 6 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 3 digits, 3,6 and 4 respectively; the second part has 2 digits, 7 and 1 respectively.
Calculate Digit Verification of CAS Registry Number 364-71:
(5*3)+(4*6)+(3*4)+(2*7)+(1*1)=66
66 % 10 = 6
So 364-71-6 is a valid CAS Registry Number.
InChI:InChI=1/C9H7FO4/c10-5-8(11)14-7-4-2-1-3-6(7)9(12)13/h1-4H,5H2,(H,12,13)
