36469-86-0 Usage
Uses
Used in Pharmaceutical and Agrochemical Industries:
4-AMINO-1,3,5-TRIAZINE-2-THIOL is used as an intermediate in the synthesis of various pharmaceuticals and agrochemicals. Its unique chemical structure allows it to be a key component in the development of new drugs and pesticides.
Used in Anticancer and Antiviral Applications:
In the field of medicine, 4-AMINO-1,3,5-TRIAZINE-2-THIOL is utilized in the development of anticancer and antiviral agents. Its potential biological activity makes it a promising candidate for the creation of new therapeutic agents to combat cancer and viral infections.
Used in Material Science:
4-AMINO-1,3,5-TRIAZINE-2-THIOL also has applications in material science. It can be employed as a corrosion inhibitor, protecting metals from degradation and extending their lifespan. Additionally, it can function as a catalyst, accelerating chemical reactions and improving industrial processes. Furthermore, its use as a UV absorber makes it valuable in the development of materials that protect against harmful ultraviolet radiation.
Check Digit Verification of cas no
The CAS Registry Mumber 36469-86-0 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 3,6,4,6 and 9 respectively; the second part has 2 digits, 8 and 6 respectively.
Calculate Digit Verification of CAS Registry Number 36469-86:
(7*3)+(6*6)+(5*4)+(4*6)+(3*9)+(2*8)+(1*6)=150
150 % 10 = 0
So 36469-86-0 is a valid CAS Registry Number.
InChI:InChI=1/C3H4N4S/c4-2-5-1-6-3(8)7-2/h1H,(H3,4,5,6,7,8)
