36475-47-5 Usage
Uses
Used in Pharmaceutical Industry:
3-METHYLHISTAMINE DIHYDROCHLORIDE is used as a synthetic intermediate for the preparation of farnesyl protein transferase, which plays a crucial role in the development and progression of various diseases, including cancer.
Used in Drug Development:
3-METHYLHISTAMINE DIHYDROCHLORIDE is used as a potential histamine H2-receptor antagonist, which can be beneficial in the development of medications targeting histamine-related conditions, such as allergies and gastric ulcers.
Check Digit Verification of cas no
The CAS Registry Mumber 36475-47-5 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 3,6,4,7 and 5 respectively; the second part has 2 digits, 4 and 7 respectively.
Calculate Digit Verification of CAS Registry Number 36475-47:
(7*3)+(6*6)+(5*4)+(4*7)+(3*5)+(2*4)+(1*7)=135
135 % 10 = 5
So 36475-47-5 is a valid CAS Registry Number.
InChI:InChI=1/C6H11N3.2ClH/c1-9-5-8-4-6(9)2-3-7;;/h4-5H,2-3,7H2,1H3;2*1H
