36508-34-6 Usage
Chemical class
Heterocyclic compound with a pyrimidinone core and a 4-(4-isoxazolyl) substituent group
Structure
The compound consists of a six-membered pyrimidinone ring fused to a five-membered isoxazolyl ring.
Functional groups
The pyrimidinone core contains a carbonyl group (C=O) and an amide group (C(O)NH), while the isoxazolyl group contains an oxygen atom and a nitrogen atom.
Biological activity
The isoxazolyl group is known to have diverse biological activities, and the compound's unique structure may contribute to its potential pharmacological properties.
Applications
The compound has potential biological and pharmaceutical applications, making it an interesting target for further research and development in drug discovery and medicinal chemistry.
Check Digit Verification of cas no
The CAS Registry Mumber 36508-34-6 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 3,6,5,0 and 8 respectively; the second part has 2 digits, 3 and 4 respectively.
Calculate Digit Verification of CAS Registry Number 36508-34:
(7*3)+(6*6)+(5*5)+(4*0)+(3*8)+(2*3)+(1*4)=116
116 % 10 = 6
So 36508-34-6 is a valid CAS Registry Number.
InChI:InChI=1/C7H5N3O2/c11-7-8-2-1-6(10-7)5-3-9-12-4-5/h1-4H,(H,8,10,11)
