36556-48-6 Usage
Uses
Used in Pharmaceutical Industry:
2-Chloro-3,4-difluoroaniline is used as a chemical intermediate for the synthesis of various pharmaceutical compounds. Its unique structure with a chlorine and two fluorine atoms allows for the development of new drugs with specific therapeutic properties.
Used in Agrochemical Industry:
In the agrochemical industry, 2-Chloro-3,4-difluoroaniline serves as a key intermediate in the production of various agrochemicals, including pesticides and herbicides. Its presence in these compounds contributes to their effectiveness in controlling pests and weeds in agricultural settings.
Used in Dye and Pigment Production:
2-Chloro-3,4-difluoroaniline is utilized as a starting material in the synthesis of dyes and pigments. Its chemical structure enables the creation of a wide range of colors and shades, making it valuable in various applications such as textiles, plastics, and printing inks.
Used in Organic Compound Synthesis:
2-Chloro-3,4-difluoroaniline is also used as a building block in the synthesis of other organic compounds. Its versatile structure allows for the development of new materials with specific properties, such as improved stability, reactivity, or selectivity in various chemical reactions.
Check Digit Verification of cas no
The CAS Registry Mumber 36556-48-6 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 3,6,5,5 and 6 respectively; the second part has 2 digits, 4 and 8 respectively.
Calculate Digit Verification of CAS Registry Number 36556-48:
(7*3)+(6*6)+(5*5)+(4*5)+(3*6)+(2*4)+(1*8)=136
136 % 10 = 6
So 36556-48-6 is a valid CAS Registry Number.
InChI:InChI=1/C6H4ClF2N/c7-5-4(10)2-1-3(8)6(5)9/h1-2H,10H2
