36556-59-9 Usage
Uses
Used in Agrochemical Production:
2-chloro-1,5-difluoro-3-nitrobenzene is utilized as a key intermediate in the synthesis of agrochemicals, contributing to the development of effective pesticides and other agricultural products designed to protect crops and enhance yield.
Used in Pharmaceutical Industry:
In the pharmaceutical sector, 2-chloro-1,5-difluoro-3-nitrobenzene serves as a crucial building block for the production of various medicinal compounds. Its unique structure allows for the creation of drugs with specific therapeutic properties, addressing a range of health conditions.
Used in Organic Synthesis:
2-chloro-1,5-difluoro-3-nitrobenzene is employed as a reactive intermediate in the synthesis of other organic compounds, facilitating the development of new materials and chemicals for diverse applications across various industries.
Check Digit Verification of cas no
The CAS Registry Mumber 36556-59-9 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 3,6,5,5 and 6 respectively; the second part has 2 digits, 5 and 9 respectively.
Calculate Digit Verification of CAS Registry Number 36556-59:
(7*3)+(6*6)+(5*5)+(4*5)+(3*6)+(2*5)+(1*9)=139
139 % 10 = 9
So 36556-59-9 is a valid CAS Registry Number.
InChI:InChI=1/C6H2ClF2NO2/c7-6-4(9)1-3(8)2-5(6)10(11)12/h1-2H
