36568-23-7 Usage
Uses
Used in Pharmaceutical Industry:
1,5-dihydro-7,8-dimethylbenzo-2,4-dithiepin is used as a potential antidepressant and antipsychotic agent for the treatment of mental health disorders. Its chemical structure and properties allow it to interact with neurotransmitter receptors in the brain, which can help regulate mood and behavior. This makes it a valuable compound for the development of new medications to address various mental health conditions.
Further research and development of 1,5-dihydro-7,8-dimethylbenzo-2,4-dithiepin may lead to the creation of innovative treatments for a range of mental health disorders, offering new therapeutic options for patients in need.
Check Digit Verification of cas no
The CAS Registry Mumber 36568-23-7 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 3,6,5,6 and 8 respectively; the second part has 2 digits, 2 and 3 respectively.
Calculate Digit Verification of CAS Registry Number 36568-23:
(7*3)+(6*6)+(5*5)+(4*6)+(3*8)+(2*2)+(1*3)=137
137 % 10 = 7
So 36568-23-7 is a valid CAS Registry Number.
InChI:InChI=1/C11H14S2/c1-8-3-10-5-12-7-13-6-11(10)4-9(8)2/h3-4H,5-7H2,1-2H3
