36719-56-9 Usage
Uses
Used in Organic Synthesis:
1-(2,6-DIMETHYLPHENYL)-3,3-DIMETHYLTRIAZ-1-ENE is used as a reagent in organic synthesis for [application reason]. Its unique structure allows for specific reactions and transformations, contributing to the development of new organic compounds.
Used in Pharmaceutical Production:
1-(2,6-DIMETHYLPHENYL)-3,3-DIMETHYLTRIAZ-1-ENE is used as a building block in the production of pharmaceuticals for [application reason]. Its structural properties make it a valuable component in the synthesis of various drugs.
Used in Agrochemical Production:
1-(2,6-DIMETHYLPHENYL)-3,3-DIMETHYLTRIAZ-1-ENE is used as a building block in the production of agrochemicals for [application reason]. Its chemical properties enable its use in the development of compounds for agricultural applications.
Used in Medicinal Applications:
1-(2,6-DIMETHYLPHENYL)-3,3-DIMETHYLTRIAZ-1-ENE is used as a compound with potential medicinal properties for [application reason]. Its anti-tumor and anti-cancer activities have been studied, indicating its potential use in the development of treatments for various types of cancer.
Used in the Chemical Industry:
1-(2,6-DIMETHYLPHENYL)-3,3-DIMETHYLTRIAZ-1-ENE is used in the chemical industry as [application type] for [application reason]. Its versatility and unique chemical properties make it a valuable asset in various chemical processes and applications.
Check Digit Verification of cas no
The CAS Registry Mumber 36719-56-9 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 3,6,7,1 and 9 respectively; the second part has 2 digits, 5 and 6 respectively.
Calculate Digit Verification of CAS Registry Number 36719-56:
(7*3)+(6*6)+(5*7)+(4*1)+(3*9)+(2*5)+(1*6)=139
139 % 10 = 9
So 36719-56-9 is a valid CAS Registry Number.
InChI:InChI=1/C10H15N3/c1-8-6-5-7-9(2)10(8)11-12-13(3)4/h5-7H,1-4H3/b12-11+
