367501-04-0 Usage
Uses
Used in Pharmaceutical Industry:
4-(4-Fluoro-2-methoxyphenoxy)piperidine is used as a chemical intermediate for the synthesis of various pharmaceutical compounds. Its unique structure, including the piperidine ring, fluorine atom, and methoxy group, contributes to its potential as a building block in the development of new drugs with improved therapeutic properties.
Used in Medicinal Chemistry Research:
4-(4-Fluoro-2-methoxyphenoxy)piperidine serves as an interesting candidate for medicinal chemistry research. The presence of the piperidine ring, a common structural motif in many biologically active compounds, allows for the exploration of its interactions with biological targets and the optimization of its pharmacological properties.
Check Digit Verification of cas no
The CAS Registry Mumber 367501-04-0 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 3,6,7,5,0 and 1 respectively; the second part has 2 digits, 0 and 4 respectively.
Calculate Digit Verification of CAS Registry Number 367501-04:
(8*3)+(7*6)+(6*7)+(5*5)+(4*0)+(3*1)+(2*0)+(1*4)=140
140 % 10 = 0
So 367501-04-0 is a valid CAS Registry Number.
InChI:InChI=1/C12H16FNO2/c1-15-12-8-9(13)2-3-11(12)16-10-4-6-14-7-5-10/h2-3,8,10,14H,4-7H2,1H3
