36770-19-1 Usage
Uses
Used in Pharmaceutical Industry:
2-(CHLOROMETHYL)-5-(4-ETHOXYPHENYL)-1,3,4-OXADIAZOLE is used as a building block for the synthesis of pharmaceutical compounds due to its unique structure and properties. The chloromethyl and ethoxyphenyl groups allow for the creation of various organic molecules with potential therapeutic applications.
Used in Agrochemical Industry:
In the agrochemical industry, 2-(CHLOROMETHYL)-5-(4-ETHOXYPHENYL)-1,3,4-OXADIAZOLE is used as a starting material for the development of new agrochemicals. Its potential antimicrobial and antiviral properties make it a promising candidate for the creation of novel pesticides and other agricultural chemicals.
Used in Antimicrobial Applications:
2-(CHLOROMETHYL)-5-(4-ETHOXYPHENYL)-1,3,4-OXADIAZOLE is used as an antimicrobial agent for its potential to inhibit the growth of various microorganisms. Its unique structure and properties allow it to target specific microbial pathways, making it a valuable tool in the development of new antimicrobial drugs.
Used in Antiviral Applications:
2-(CHLOROMETHYL)-5-(4-ETHOXYPHENYL)-1,3,4-OXADIAZOLE is also used in antiviral applications due to its potential to interfere with viral replication and infection processes. The ethoxyphenyl group may contribute to its antiviral activity, providing a basis for further research and development of new antiviral drugs.
Used in Anticancer Applications:
2-(CHLOROMETHYL)-5-(4-ETHOXYPHENYL)-1,3,4-OXADIAZOLE is used as a potential anticancer agent due to its ability to target and inhibit the growth of cancer cells. Its unique structure and properties make it a promising candidate for further research and development in the field of oncology.
Used in Drug Development:
In the field of drug development, 2-(CHLOROMETHYL)-5-(4-ETHOXYPHENYL)-1,3,4-OXADIAZOLE serves as a valuable compound for the synthesis of new drugs with diverse therapeutic applications. Its versatility and potential biological activities make it an important tool in the discovery and development of novel pharmaceuticals.
Check Digit Verification of cas no
The CAS Registry Mumber 36770-19-1 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 3,6,7,7 and 0 respectively; the second part has 2 digits, 1 and 9 respectively.
Calculate Digit Verification of CAS Registry Number 36770-19:
(7*3)+(6*6)+(5*7)+(4*7)+(3*0)+(2*1)+(1*9)=131
131 % 10 = 1
So 36770-19-1 is a valid CAS Registry Number.
InChI:InChI=1/C11H11ClN2O2/c1-2-15-9-5-3-8(4-6-9)11-14-13-10(7-12)16-11/h3-6H,2,7H2,1H3
36770-19-1Relevant academic research and scientific papers
SUBSTITUTED TRIAZOLE DERIVATIVES AS OXYTOCIN ANTAGONISTS
-
Page/Page column 75, (2010/02/13)
The present invention relates to a class of substituted triazoles of formula (I) with activity as oxytocin antagonists, uses thereof, processes for the preparation thereof and compositions containing said inhibitors. These inhibitors have utility in a variety of therapeutic areas including sexual dysfunction, particularly premature ejaculation (P.E.).
