36875-34-0 Usage
Uses
Used in Organic Synthesis:
DIMETHYL THREO-2-BROMO-3-FLUOROSUCCINATE is used as a building block in organic synthesis for the creation of more complex molecules. Its unique structure, which includes a bromine and a fluorine atom, allows for versatile chemical reactions and the formation of a wide range of compounds.
Used in Pharmaceutical Industry:
In the pharmaceutical industry, DIMETHYL THREO-2-BROMO-3-FLUOROSUCCINATE is used as a precursor in the development of new drugs. Its diverse chemical properties make it a valuable component in the synthesis of pharmaceutical compounds, potentially contributing to the discovery of novel therapeutic agents.
Used in Agrochemical Industry:
DIMETHYL THREO-2-BROMO-3-FLUOROSUCCINATE also finds application in the agrochemical industry, where it is utilized as a starting material for the synthesis of agrochemicals. Its chemical versatility can lead to the development of new pesticides, herbicides, or other agricultural chemicals that can improve crop protection and yield.
Check Digit Verification of cas no
The CAS Registry Mumber 36875-34-0 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 3,6,8,7 and 5 respectively; the second part has 2 digits, 3 and 4 respectively.
Calculate Digit Verification of CAS Registry Number 36875-34:
(7*3)+(6*6)+(5*8)+(4*7)+(3*5)+(2*3)+(1*4)=150
150 % 10 = 0
So 36875-34-0 is a valid CAS Registry Number.
InChI:InChI=1/C6H8BrFO4/c1-11-5(9)3(7)4(8)6(10)12-2/h3-4H,1-2H3/t3-,4+/m1/s1
