36877-68-6 Usage
General Description
2-Nitro-1H-imidazole is a chemical compound with the molecular formula C3H3N3O2. It is a nitroimidazole derivative, typically used in pharmaceuticals and as a building block for organic synthesis. 2-nitro-1H-imidazole is known for its antifungal and antibacterial properties, making it useful in the treatment of various infections. 2-Nitro-1H-imidazole is also used as a reagent in the synthesis of other organic compounds and can act as a mild oxidizing agent in certain chemical reactions. Its chemical structure and properties make it a valuable component in various industries, including pharmaceuticals, agriculture, and research.
Check Digit Verification of cas no
The CAS Registry Mumber 36877-68-6 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 3,6,8,7 and 7 respectively; the second part has 2 digits, 6 and 8 respectively.
Calculate Digit Verification of CAS Registry Number 36877-68:
(7*3)+(6*6)+(5*8)+(4*7)+(3*7)+(2*6)+(1*8)=166
166 % 10 = 6
So 36877-68-6 is a valid CAS Registry Number.
InChI:InChI=1/C3H3N3O2/c7-6(8)3-4-1-2-5-3/h1-2H,(H,4,5)
Xn:Harmful;
