368869-96-9 Usage
Uses
Used in Organic Synthesis:
ETHYL 4-BROMO-3,5-DIMETHYL-1H-PYRROLE-2-CARBOXYLATE is used as a key intermediate in organic synthesis for the preparation of various complex organic molecules. Its unique structure allows for further functionalization and modification, making it a versatile building block in the synthesis of specialty chemicals.
Used in Medicinal Chemistry:
In the pharmaceutical industry, ETHYL 4-BROMO-3,5-DIMETHYL-1H-PYRROLE-2-CARBOXYLATE is used as a starting material for the development of new drugs. Its presence in the molecular structure can potentially enhance the pharmacological properties of the resulting compounds, such as potency, selectivity, and bioavailability.
Used in Agrochemicals:
ETHYL 4-BROMO-3,5-DIMETHYL-1H-PYRROLE-2-CARBOXYLATE is also utilized in the agrochemical industry as a precursor for the synthesis of bioactive compounds with pesticidal properties. Its incorporation into the molecular structure of agrochemicals can lead to the development of more effective and targeted pest control agents.
Used in Drug Discovery:
In drug discovery research, ETHYL 4-BROMO-3,5-DIMETHYL-1H-PYRROLE-2-CARBOXYLATE is employed as a potential scaffold for the design and synthesis of novel therapeutic agents. Its unique structural features can be exploited to develop compounds with improved pharmacological profiles, such as increased potency, selectivity, and reduced side effects.
Used in Chemical Research:
ETHYL 4-BROMO-3,5-DIMETHYL-1H-PYRROLE-2-CARBOXYLATE serves as a valuable research tool in chemical research, particularly in the study of pyrrole chemistry and its applications. Its unique properties and reactivity can provide insights into the development of new synthetic methods, reaction mechanisms, and the exploration of novel chemical space.
Check Digit Verification of cas no
The CAS Registry Mumber 368869-96-9 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 3,6,8,8,6 and 9 respectively; the second part has 2 digits, 9 and 6 respectively.
Calculate Digit Verification of CAS Registry Number 368869-96:
(8*3)+(7*6)+(6*8)+(5*8)+(4*6)+(3*9)+(2*9)+(1*6)=229
229 % 10 = 9
So 368869-96-9 is a valid CAS Registry Number.
InChI:InChI=1/C11H9BrN2O/c1-8-2-7-11(14-13-8)15-10-5-3-9(12)4-6-10/h2-7H,1H3
