368869-99-2 Usage
Uses
Used in Pharmaceutical Research and Drug Development:
4-HYDROXYMETHYL-3,5-DIMETHYL-1H-PYRROLE-2-CARBOXYLIC ACID ETHYL ESTER is used as a potential building block for creating novel medications due to its unique structural properties and pharmacological activities. Its presence in the pyrrole carboxylic acid family contributes to its potential as a precursor for developing new therapeutic agents.
Used in Organic Synthesis:
In the field of organic synthesis, 4-HYDROXYMETHYL-3,5-DIMETHYL-1H-PYRROLE-2-CARBOXYLIC ACID ETHYL ESTER is utilized as a key intermediate for the synthesis of various organic compounds. Its versatile structure allows for the formation of a wide range of chemical products.
Used in Chemical Manufacturing:
4-HYDROXYMETHYL-3,5-DIMETHYL-1H-PYRROLE-2-CARBOXYLIC ACID ETHYL ESTER is employed in chemical manufacturing processes, where it serves as a raw material or a catalyst in the production of other chemical substances. Its role in these processes is crucial for the synthesis of various industrial chemicals.
Used in Biotechnology:
In the biotechnology industry, 4-HYDROXYMETHYL-3,5-DIMETHYL-1H-PYRROLE-2-CARBOXYLIC ACID ETHYL ESTER may have applications in the development of new biological tools and products. Its unique properties could be harnessed for the creation of innovative solutions in areas such as diagnostics, therapeutics, and biomaterials.
Safety Precautions:
As with any chemical substance, proper handling and safety precautions should be observed when working with 4-HYDROXYMETHYL-3,5-DIMETHYL-1H-PYRROLE-2-CARBOXYLIC ACID ETHYL ESTER. This includes wearing appropriate personal protective equipment, working in a well-ventilated area, and following established safety protocols to minimize potential risks.
Check Digit Verification of cas no
The CAS Registry Mumber 368869-99-2 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 3,6,8,8,6 and 9 respectively; the second part has 2 digits, 9 and 9 respectively.
Calculate Digit Verification of CAS Registry Number 368869-99:
(8*3)+(7*6)+(6*8)+(5*8)+(4*6)+(3*9)+(2*9)+(1*9)=232
232 % 10 = 2
So 368869-99-2 is a valid CAS Registry Number.
InChI:InChI=1/C10H15NO3/c1-4-14-10(13)9-6(2)8(5-12)7(3)11-9/h11-12H,4-5H2,1-3H3
Xi:Irritant;
