369656-76-8 Usage
Uses
Used in Pharmaceutical Industry:
2'-DEOXYURIDINE-2-13C,1,3-15N2 is used as a therapeutic agent for the treatment of various medical conditions, including allergy, cancer, infection, and autoimmune diseases. The stable isotope labeling allows for better tracking and understanding of the compound's behavior within the body, which can lead to improved treatment strategies and outcomes.
Used in Research and Development:
In the field of research and development, 2'-DEOXYURIDINE-2-13C,1,3-15N2 can be used as a labeled reference compound for studying the mechanisms of action, metabolic pathways, and interactions with other molecules. The stable isotope labeling provides a unique signature that can be detected and analyzed using various analytical techniques, such as mass spectrometry.
Used in Diagnostic Applications:
2'-DEOXYURIDINE-2-13C,1,3-15N2 can also be employed in diagnostic applications, where its stable isotope labeling can help in the detection and monitoring of specific biological processes or conditions. This can be particularly useful in the development of new diagnostic tools and tests for various diseases and conditions.
Overall, 2'-DEOXYURIDINE-2-13C,1,3-15N2 is a versatile compound with potential applications in the pharmaceutical, research and development, and diagnostic industries. Its unique properties and stable isotope labeling make it a valuable tool for understanding and treating various medical conditions.
Check Digit Verification of cas no
The CAS Registry Mumber 369656-76-8 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 3,6,9,6,5 and 6 respectively; the second part has 2 digits, 7 and 6 respectively.
Calculate Digit Verification of CAS Registry Number 369656-76:
(8*3)+(7*6)+(6*9)+(5*6)+(4*5)+(3*6)+(2*7)+(1*6)=208
208 % 10 = 8
So 369656-76-8 is a valid CAS Registry Number.
InChI:InChI=1/C9H12N2O5/c12-4-6-5(13)3-8(16-6)11-2-1-7(14)10-9(11)15/h1-2,5-6,8,12-13H,3-4H2,(H,10,14,15)/t5-,6-,8-/m1/s1/i9+1,10+1,11+1