37033-21-9 Usage
Uses
Used in Pharmaceutical Industry:
2,4-Diamino-5-cyclohexyl-6-methylpyrimidine is used as a chemical intermediate for the synthesis of various pharmaceuticals. Its unique structure and functional groups make it a valuable building block in the development of new drugs and treatments.
Used in Agrochemical Industry:
2,4-Diamino-5-cyclohexyl-6-methylpyrimidine is also used as an intermediate in the synthesis of agrochemicals. Its potential biological activities, such as antimicrobial properties, can be harnessed to create effective compounds for agricultural applications, such as pesticides or fungicides.
Used in Antiviral Applications:
2,4-Diamino-5-cyclohexyl-6-methylpyrimidine is studied for its potential antiviral properties. It may be used as a component in the development of antiviral drugs, contributing to the fight against viral infections and diseases.
Used in Antimicrobial Applications:
Due to its antimicrobial properties, 2,4-Diamino-5-cyclohexyl-6-methylpyrimidine may be used in the development of new antimicrobial agents. These could be applied in various fields, such as medicine, agriculture, or industrial processes, to combat bacterial and fungal infections.
Check Digit Verification of cas no
The CAS Registry Mumber 37033-21-9 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 3,7,0,3 and 3 respectively; the second part has 2 digits, 2 and 1 respectively.
Calculate Digit Verification of CAS Registry Number 37033-21:
(7*3)+(6*7)+(5*0)+(4*3)+(3*3)+(2*2)+(1*1)=89
89 % 10 = 9
So 37033-21-9 is a valid CAS Registry Number.
InChI:InChI=1/C11H18N4/c1-7-9(8-5-3-2-4-6-8)10(12)15-11(13)14-7/h8H,2-6H2,1H3,(H4,12,13,14,15)
