372-44-1

Usage

Uses

Used in Organic Synthesis:
Phenol-boron trifluoride is used as a catalyst for facilitating the formation of carbon-carbon and carbon-oxygen bonds in organic synthesis. Its ability to stabilize intermediates and lower activation energies makes it a valuable component in the synthesis of complex organic molecules, including pharmaceuticals and specialty chemicals.
Used in Polymerization Reactions:
In the polymer industry, phenol-boron trifluoride is utilized as a catalyst to initiate and control polymerization processes. Its role in these reactions is crucial for the production of polymers with desired molecular weights and structures, which are essential for specific applications.
Used in Manufacturing of Resins:
Phenol-boron trifluoride is used as a cross-linking agent in the production of resins. Its presence in the reaction mixture promotes the formation of a three-dimensional network within the resin, enhancing its mechanical properties, thermal stability, and chemical resistance.
Used in Plastics Production:
Phenol-boron trifluoride is employed in the manufacturing of various types of plastics to improve their structural properties. By acting as a catalyst for cross-linking reactions, it contributes to the development of plastics with increased strength, durability, and resistance to environmental factors.
Used in Adhesive Formulation:
In the adhesive industry, phenol-boron trifluoride is used to enhance the bonding strength and durability of adhesives. Its catalytic action in cross-linking reactions results in the formation of a robust adhesive matrix that provides strong adhesion to various substrates.
Overall, phenol-boron trifluoride is a versatile chemical compound with a wide range of applications across different industries, primarily due to its catalytic properties and ability to promote the formation of essential chemical bonds.

InChI:InChI=1/C6H3F3O.B/c7-3-1-2-4(10)6(9)5(3)8;/h1-2,10H;