372144-12-2 Usage
Uses
Used in Pharmaceutical Industry:
3-N-CBZ-AMINO-3-PIPERIDINE-PROPIONIC ACID is used as a building block for the synthesis of various pharmaceutical drugs. Its unique structure and functional groups enable the creation of diverse drug candidates with potential therapeutic applications.
Used in Medicinal Chemistry Research:
3-N-CBZ-AMINO-3-PIPERIDINE-PROPIONIC ACID is utilized as a key component in the development of new drug candidates. Its ability to selectively modify specific functional groups allows researchers to explore novel chemical entities with improved pharmacological properties.
Used in Therapeutic Applications:
3-N-CBZ-AMINO-3-PIPERIDINE-PROPIONIC ACID has been studied for its potential as an anti-inflammatory and analgesic agent. Its unique chemical properties and interactions with biological targets make it a promising candidate for the treatment of pain and inflammation-related disorders.
Check Digit Verification of cas no
The CAS Registry Mumber 372144-12-2 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 3,7,2,1,4 and 4 respectively; the second part has 2 digits, 1 and 2 respectively.
Calculate Digit Verification of CAS Registry Number 372144-12:
(8*3)+(7*7)+(6*2)+(5*1)+(4*4)+(3*4)+(2*1)+(1*2)=122
122 % 10 = 2
So 372144-12-2 is a valid CAS Registry Number.
InChI:InChI=1/C16H22N2O4/c19-15(20)9-14(13-7-4-8-17-10-13)18-16(21)22-11-12-5-2-1-3-6-12/h1-3,5-6,13-14,17H,4,7-11H2,(H,18,21)(H,19,20)
