37279-99-5 Usage
General Description
Desferri-ferricrocin is a chemical compound that belongs to the class of iron-chelating siderophores, which are produced by microorganisms to scavenge iron from the environment. desferri-ferricrocin is specifically known for its ability to bind and sequester iron, making it a potential candidate for the treatment of iron-overload disorders such as thalassemia and hemochromatosis. In addition to its iron-binding properties, desferri-ferricrocin has also been studied for its potential antioxidant and anti-inflammatory effects, making it a promising candidate for the development of new pharmaceuticals. Overall, desferri-ferricrocin plays a key role in iron metabolism and has potential therapeutic applications in the treatment of iron-related disorders.
Check Digit Verification of cas no
The CAS Registry Mumber 37279-99-5 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 3,7,2,7 and 9 respectively; the second part has 2 digits, 9 and 9 respectively.
Calculate Digit Verification of CAS Registry Number 37279-99:
(7*3)+(6*7)+(5*2)+(4*7)+(3*9)+(2*9)+(1*9)=155
155 % 10 = 5
So 37279-99-5 is a valid CAS Registry Number.
InChI:InChI=1/C28H47N9O13/c1-16(39)35(48)10-4-7-19-25(44)29-14-24(43)32-22(15-38)26(45)30-13-23(42)31-20(8-5-11-36(49)17(2)40)27(46)34-21(28(47)33-19)9-6-12-37(50)18(3)41/h19-22,38,48-50H,4-15H2,1-3H3,(H,29,44)(H,30,45)(H,31,42)(H,32,43)(H,33,47)(H,34,46)/t19-,20+,21+,22+/m1/s1