373-26-2 Usage
Type of compound
Fluoroalkyl compound
Ester derivative
12-Fluorododecanoic acid
Potential use
Building block in the synthesis of other fluoroalkyl compounds
Common use
Starting material for the production of fluorinated surfactants
Industrial applications
Production of various polymers and specialty chemicals
Research settings
Used in research for its unique properties and potential applications
Industries
Pharmaceutical, agrochemical, and materials science
Chemical structure
Consists of a 12-carbon chain with a fluorine atom attached to the 12th carbon, and an ester functional group formed by the reaction of the carboxylic acid group with ethanol
Physical state
Likely a liquid at room temperature, due to its relatively large molecular size and the presence of the fluorine atom
Solubility
Soluble in organic solvents, such as ethanol, methanol, and acetone, but may have limited solubility in water
Stability
Generally stable under normal conditions, but sensitive to heat, light, and strong acids or bases
Safety precautions
Handle with care, as it may be harmful if inhaled, ingested, or comes into contact with the skin
Environmental impact
Potentially persistent in the environment due to the presence of the fluorine atom, and may have negative effects on aquatic life if released into water systems
Regulatory status
May be subject to specific regulations and guidelines depending on the intended use and location of production or application.
Check Digit Verification of cas no
The CAS Registry Mumber 373-26-2 includes 6 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 3 digits, 3,7 and 3 respectively; the second part has 2 digits, 2 and 6 respectively.
Calculate Digit Verification of CAS Registry Number 373-26:
(5*3)+(4*7)+(3*3)+(2*2)+(1*6)=62
62 % 10 = 2
So 373-26-2 is a valid CAS Registry Number.
InChI:InChI=1/C14H27FO2/c1-2-17-14(16)12-10-8-6-4-3-5-7-9-11-13-15/h2-13H2,1H3
