373384-19-1 Usage
Uses
Used in Organic Synthesis:
(1,2-dihydro-2-oxo-5-Pyrimidinyl)-boronic acid is used as a reagent in organic synthesis for its ability to form reversible covalent bonds with other molecules. This property makes it a valuable tool in the synthesis of complex organic compounds and the development of new chemical reactions.
Used in Pharmaceutical Development:
In the pharmaceutical industry, (1,2-dihydro-2-oxo-5-Pyrimidinyl)-boronic acid is used as a building block for the development of new drugs. Its anti-inflammatory and anticancer properties have been investigated for potential therapeutic applications in treating various diseases. The boronic acid moiety in (1,2-dihydro-2-oxo-5-Pyrimidinyl)-boronic acid allows for targeted drug delivery and enhanced efficacy.
Used in Catalysis:
(1,2-dihydro-2-oxo-5-Pyrimidinyl)-boronic acid is employed as a catalyst in various chemical reactions due to its ability to form reversible covalent bonds. This feature enables it to facilitate reactions and improve the overall efficiency of the process.
Used in Biological Research:
In the field of biological research, (1,2-dihydro-2-oxo-5-Pyrimidinyl)-boronic acid is used as a tool for probing biological processes. Its ability to form reversible covalent bonds allows researchers to study the interactions between biomolecules and gain insights into the underlying mechanisms of various biological phenomena.
Check Digit Verification of cas no
The CAS Registry Mumber 373384-19-1 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 3,7,3,3,8 and 4 respectively; the second part has 2 digits, 1 and 9 respectively.
Calculate Digit Verification of CAS Registry Number 373384-19:
(8*3)+(7*7)+(6*3)+(5*3)+(4*8)+(3*4)+(2*1)+(1*9)=161
161 % 10 = 1
So 373384-19-1 is a valid CAS Registry Number.
InChI:InChI=1/C4H5BN2O3/c8-4-6-1-3(2-7-4)5(9)10/h1-2,9-10H,(H,6,7,8)
