374064-02-5 Usage
Uses
Used in Pharmaceutical and Agrochemical Industries:
5-Pyridin-2-yl-1H-pyrazole-3-carboxylic acid is utilized as a starting material in organic synthesis for the preparation of various pharmaceuticals and agrochemicals. Its unique structure and properties make it a valuable component in the development of new drugs and pesticides.
Used in Medicinal Research:
As a compound with potential biological activities, 5-Pyridin-2-yl-1H-pyrazole-3-carboxylic acid is used as a research tool in medicinal chemistry. It is particularly valuable for exploring its anti-inflammatory, anti-cancer, and anti-bacterial properties, which could lead to the discovery of new therapeutic agents.
Used in Coordination Chemistry:
5-Pyridin-2-yl-1H-pyrazole-3-carboxylic acid is employed as a ligand in coordination chemistry, where it plays a crucial role in the formation of coordination compounds. These compounds are then applied in various fields, such as catalysis and materials science, to enhance the performance of chemical reactions and develop new materials with specific properties.
Used in Catalysis:
In the field of catalysis, 5-Pyridin-2-yl-1H-pyrazole-3-carboxylic acid is used to create coordination compounds that can act as catalysts. These catalysts can improve the efficiency and selectivity of chemical reactions, leading to more sustainable and cost-effective processes.
Used in Materials Science:
5-Pyridin-2-yl-1H-pyrazole-3-carboxylic acid is also used in materials science for the preparation of coordination compounds that can be incorporated into advanced materials with unique properties. These materials can be used in various applications, such as sensors, energy storage devices, and electronic components.
Check Digit Verification of cas no
The CAS Registry Mumber 374064-02-5 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 3,7,4,0,6 and 4 respectively; the second part has 2 digits, 0 and 2 respectively.
Calculate Digit Verification of CAS Registry Number 374064-02:
(8*3)+(7*7)+(6*4)+(5*0)+(4*6)+(3*4)+(2*0)+(1*2)=135
135 % 10 = 5
So 374064-02-5 is a valid CAS Registry Number.
InChI:InChI=1/C9H7N3O2/c13-9(14)8-5-7(11-12-8)6-3-1-2-4-10-6/h1-4H,5H2,(H,13,14)
374064-02-5Relevant articles and documents
NOVEL PIPERAZINE DERIVATIVES AS INHIBITORS OF STEAROYL-COA DESATURASE
-
Page/Page column 39, (2010/07/04)
The present invention relates to piperazine derivatives that act as inhibitors of stearoyl-CoA desaturase. The invention also relates to methods of preparing the compounds, compositions containing the compounds, and to methods of treatment using the compounds.
