374064-04-7 Usage
General Description
1-Pyridin-3-ylbutane-1,4-diamine, also known as PD168393, is a chemical compound that is often used in research and pharmaceutical development. It is a selective inhibitor of the ErbB receptor tyrosine kinase, which plays a significant role in cell proliferation and survival. PD168393 has been studied for its potential applications in cancer treatment, as it specifically targets the ErbB family of receptors that are commonly overexpressed in cancer cells. 1-PYRIDIN-3-YLBUTANE-1,4-DIAMINE has shown promise in inhibiting the growth and signaling of cancer cells, making it a potential candidate for further drug development. Additionally, it has also been studied for its potential role in other diseases and conditions related to the ErbB receptors, such as neurodegenerative disorders and cardiovascular diseases.
Check Digit Verification of cas no
The CAS Registry Mumber 374064-04-7 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 3,7,4,0,6 and 4 respectively; the second part has 2 digits, 0 and 4 respectively.
Calculate Digit Verification of CAS Registry Number 374064-04:
(8*3)+(7*7)+(6*4)+(5*0)+(4*6)+(3*4)+(2*0)+(1*4)=137
137 % 10 = 7
So 374064-04-7 is a valid CAS Registry Number.
InChI:InChI=1/C9H15N3/c10-5-1-4-9(11)8-3-2-6-12-7-8/h2-3,6-7,9H,1,4-5,10-11H2
