374064-08-1 Usage
Uses
Used in Pharmaceutical Research and Drug Development:
2-(2-Pyridin-2-yl-1H-indol-3-yl)ethanamine monohydrochloride is utilized as a potential therapeutic agent for various diseases due to its unique structure and properties. It is particularly promising for the treatment of cancer, neurological disorders, and inflammatory conditions, as it can be further explored and modified for specific medicinal applications.
Used in Medicinal Chemistry:
In the field of medicinal chemistry, 2-(2-Pyridin-2-yl-1H-indol-3-yl)ethanamine monohydrochloride serves as a valuable compound for the development of new drugs. Its heterocyclic nature and the presence of both pyridine and indole rings provide a foundation for designing molecules with targeted therapeutic effects, making it a promising candidate for creating innovative pharmaceuticals.
Check Digit Verification of cas no
The CAS Registry Mumber 374064-08-1 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 3,7,4,0,6 and 4 respectively; the second part has 2 digits, 0 and 8 respectively.
Calculate Digit Verification of CAS Registry Number 374064-08:
(8*3)+(7*7)+(6*4)+(5*0)+(4*6)+(3*4)+(2*0)+(1*8)=141
141 % 10 = 1
So 374064-08-1 is a valid CAS Registry Number.
InChI:InChI=1/C15H15N3.ClH/c16-9-8-12-11-5-1-2-6-13(11)18-15(12)14-7-3-4-10-17-14;/h1-7,10,18H,8-9,16H2;1H
