374105-86-9 Usage
Uses
Used in Organic Chemistry:
2-(2-Carboxyvinyl)benzeneboronic acid is used as a building block for synthesizing complex organic molecules. Its versatile structure allows for the creation of a wide range of compounds, making it an essential component in the development of new chemical entities.
Used in Pharmaceutical Research:
In the pharmaceutical industry, 2-(2-Carboxyvinyl)benzeneboronic acid is utilized as a key intermediate in the synthesis of potential drug candidates. Its capacity to engage in specific chemical reactions facilitates the design and production of novel therapeutic agents.
Used in Agrochemical Development:
2-(2-Carboxyvinyl)benzeneboronic acid also finds application in the agrochemical sector, where it serves as a precursor for the synthesis of bioactive compounds used in pest control and crop protection.
Used for Chemical Synthesis and Drug Discovery:
The boronic acid group in 2-(2-Carboxyvinyl)benzeneboronic acid is known for its reactivity, making it a valuable tool in chemical synthesis. It is particularly useful in the discovery of new drugs, where its ability to form reversible bonds can be harnessed to create molecules with desired biological activities.
Used for Modification and Functionalization:
The carboxyvinyl group present in the compound provides additional points for modification, allowing scientists to tailor the molecule for specific chemical reactions and applications, thus expanding its utility across various chemical and biological processes.
Check Digit Verification of cas no
The CAS Registry Mumber 374105-86-9 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 3,7,4,1,0 and 5 respectively; the second part has 2 digits, 8 and 6 respectively.
Calculate Digit Verification of CAS Registry Number 374105-86:
(8*3)+(7*7)+(6*4)+(5*1)+(4*0)+(3*5)+(2*8)+(1*6)=139
139 % 10 = 9
So 374105-86-9 is a valid CAS Registry Number.
InChI:InChI=1/C9H9BO4/c11-9(12)6-5-7-3-1-2-4-8(7)10(13)14/h1-6,13-14H,(H,11,12)/b6-5+
