374537-99-2 Usage
Uses
Used in Pharmaceutical Industry:
7-AMINO-5-BROMOINDOLE is used as a building block for the synthesis of pharmaceuticals. Its unique structure allows it to be incorporated into the development of new drugs, potentially leading to the discovery of novel therapeutic agents with improved efficacy and selectivity.
Used in Agrochemical Industry:
In the agrochemical industry, 7-AMINO-5-BROMOINDOLE is utilized as a key intermediate in the synthesis of various agrochemicals. Its reactivity and structural features enable the creation of new compounds with potential applications in crop protection, pest control, and other agricultural areas.
Used in Material Science:
7-AMINO-5-BROMOINDOLE is studied for its potential use in the development of novel materials. Its chemical properties and structure make it a promising candidate for the creation of new materials with unique properties, such as improved stability, conductivity, or other desirable characteristics.
Used as a Reactive Intermediate in Organic Synthesis:
Due to its reactivity and structural features, 7-AMINO-5-BROMOINDOLE serves as a reactive intermediate in various organic synthesis processes. It can be used to form a wide range of chemical compounds, contributing to the advancement of organic chemistry and the development of new chemical products.
Commercial Availability:
7-AMINO-5-BROMOINDOLE is available commercially for research and industrial purposes. Its accessibility allows researchers and industry professionals to explore its potential applications and incorporate it into their work, further expanding the scope of its uses and contributions to various fields.
Check Digit Verification of cas no
The CAS Registry Mumber 374537-99-2 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 3,7,4,5,3 and 7 respectively; the second part has 2 digits, 9 and 9 respectively.
Calculate Digit Verification of CAS Registry Number 374537-99:
(8*3)+(7*7)+(6*4)+(5*5)+(4*3)+(3*7)+(2*9)+(1*9)=182
182 % 10 = 2
So 374537-99-2 is a valid CAS Registry Number.
InChI:InChI=1/C8H7BrN2/c9-6-3-5-1-2-11-8(5)7(10)4-6/h1-4,11H,10H2
