3748-39-8 Usage
Uses
Used in Pharmaceutical Industry:
TMC-256B1 is used as a therapeutic agent for its potential medicinal properties. TMC-256B1's unique structure allows it to interact with specific biological targets, making it a promising candidate for the development of new drugs to treat various diseases and conditions.
Used in Chemical Research:
In the field of chemical research, TMC-256B1 serves as a valuable compound for studying its chemical properties, reactivity, and potential applications in the synthesis of other complex molecules. Its unique structure can provide insights into the development of new chemical reactions and processes.
Used in Material Science:
TMC-256B1's distinct molecular structure may offer potential applications in material science, where it could be utilized in the development of new materials with specific properties. These materials could have applications in various industries, such as electronics, aerospace, or automotive, depending on the properties conferred by the TMC-256B1 compound.
Used in Environmental Applications:
TMC-256B1's unique structure and properties may also find use in environmental applications, such as in the development of new methods for pollution control, waste management, or energy production. Further research and development in this area could lead to innovative solutions for environmental challenges.
Check Digit Verification of cas no
The CAS Registry Mumber 3748-39-8 includes 7 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 4 digits, 3,7,4 and 8 respectively; the second part has 2 digits, 3 and 9 respectively.
Calculate Digit Verification of CAS Registry Number 3748-39:
(6*3)+(5*7)+(4*4)+(3*8)+(2*3)+(1*9)=108
108 % 10 = 8
So 3748-39-8 is a valid CAS Registry Number.
InChI:InChI=1/C15H14O6/c1-15(19)6-9(17)13-11(21-15)4-7-3-8(16)5-10(20-2)12(7)14(13)18/h3-5,16,18-19H,6H2,1-2H3
