37527-29-0 Usage
Uses
Used in Pharmaceutical Industry:
1H-Purine-6-carboxamide(9CI) is used as a pharmaceutical intermediate for the synthesis of various therapeutic agents. Its unique chemical structure allows it to be a key component in the development of drugs targeting specific biological pathways.
Used in Research and Development:
In the field of research and development, 1H-Purine-6-carboxamide(9CI) serves as a valuable compound for studying the structure-activity relationships of purine-based molecules. This helps in understanding the molecular mechanisms of various biological processes and the design of novel therapeutic agents.
Used in Chemical Synthesis:
1H-Purine-6-carboxamide(9CI) is used as a building block in the synthesis of more complex organic compounds, particularly those with potential applications in the pharmaceutical, agrochemical, and materials science industries. Its versatile chemical structure makes it a valuable starting material for the development of new molecules with specific properties and functions.
Check Digit Verification of cas no
The CAS Registry Mumber 37527-29-0 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 3,7,5,2 and 7 respectively; the second part has 2 digits, 2 and 9 respectively.
Calculate Digit Verification of CAS Registry Number 37527-29:
(7*3)+(6*7)+(5*5)+(4*2)+(3*7)+(2*2)+(1*9)=130
130 % 10 = 0
So 37527-29-0 is a valid CAS Registry Number.
InChI:InChI=1/C6H5N5O/c7-5(12)3-4-6(10-1-8-3)11-2-9-4/h1-2,4H,(H2,7,12)
