375368-80-2 Usage
Uses
Used in Pharmaceutical Industry:
3-Fluoro-2-methoxy-6-picoline serves as a key intermediate in the synthesis of various pharmaceutical compounds. Its presence in the molecular structure allows for enhanced biological activity and selectivity, making it a valuable component in the development of new drugs with improved efficacy and safety profiles.
Used in Agrochemical Industry:
In the agrochemical sector, 3-Fluoro-2-methoxy-6-picoline is utilized as a precursor for the production of pesticides and other crop protection agents. 3-Fluoro-2-methoxy-6-picoline's unique structural features contribute to the design of novel agrochemicals with increased potency and selectivity, thereby reducing the environmental impact and improving crop yields.
Used in Organic Synthesis:
3-Fluoro-2-methoxy-6-picoline is employed as a versatile building block in organic synthesis, enabling the construction of complex molecular architectures. Its fluorine and methoxy groups facilitate various chemical reactions and functional group manipulations, making it an indispensable component in the synthesis of advanced materials, specialty chemicals, and other organic compounds for research and industrial applications.
Check Digit Verification of cas no
The CAS Registry Mumber 375368-80-2 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 3,7,5,3,6 and 8 respectively; the second part has 2 digits, 8 and 0 respectively.
Calculate Digit Verification of CAS Registry Number 375368-80:
(8*3)+(7*7)+(6*5)+(5*3)+(4*6)+(3*8)+(2*8)+(1*0)=182
182 % 10 = 2
So 375368-80-2 is a valid CAS Registry Number.
InChI:InChI=1/C8H11NO/c1-6-4-5-7(2)9-8(6)10-3/h4-5H,1-3H3
