3759-75-9 Usage
Molecular Structure
2-[(thien-2-ylmethyl)thio]benzoic acid is a chemical compound that contains a benzene ring, a thioether functional group, and a carboxylic acid group.
Functional Groups
The compound has a thioether group that includes a thien-2-ylmethyl moiety, which is a five-membered heterocycle containing sulfur.
Usage
The compound is often used as a building block in organic synthesis and medicinal chemistry.
Potential Applications
2-[(thien-2-ylmethyl)thio]benzoic acid may have potential pharmaceutical applications due to its structural features and potential biological activities.
Unique Value
Its unique structure and reactivity make it a valuable tool in the development of new drugs and materials.
Check Digit Verification of cas no
The CAS Registry Mumber 3759-75-9 includes 7 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 4 digits, 3,7,5 and 9 respectively; the second part has 2 digits, 7 and 5 respectively.
Calculate Digit Verification of CAS Registry Number 3759-75:
(6*3)+(5*7)+(4*5)+(3*9)+(2*7)+(1*5)=119
119 % 10 = 9
So 3759-75-9 is a valid CAS Registry Number.
InChI:InChI=1/C12H10O2S2/c13-12(14)10-5-1-2-6-11(10)16-8-9-4-3-7-15-9/h1-7H,8H2,(H,13,14)
