3764-00-9 Usage
Uses
Used in Pharmaceutical Industry:
4,6-Dichloro-2-(chloroMethyl)-5-MethylpyriMidine is used as an intermediate in the synthesis of antiviral and anticancer drugs. Its unique structure allows for the development of compounds that can target specific viral and cancer cells, making it a valuable component in the creation of effective treatments.
Used in Agrochemical Industry:
In the agrochemical industry, 4,6-Dichloro-2-(chloroMethyl)-5-MethylpyriMidine is used as an intermediate for the production of herbicides and insecticides. Its ability to be modified and incorporated into various chemical structures makes it a useful component in the development of effective and targeted pest control solutions.
Due to the potential toxicity and environmental impact of 4,6-Dichloro-2-(chloroMethyl)-5-MethylpyriMidine, it is crucial to handle and dispose of 4,6-Dichloro-2-(chloroMethyl)-5-MethylpyriMidine with care in both industrial and laboratory settings. This ensures the safety of workers and minimizes any negative effects on the environment.
Check Digit Verification of cas no
The CAS Registry Mumber 3764-00-9 includes 7 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 4 digits, 3,7,6 and 4 respectively; the second part has 2 digits, 0 and 0 respectively.
Calculate Digit Verification of CAS Registry Number 3764-00:
(6*3)+(5*7)+(4*6)+(3*4)+(2*0)+(1*0)=89
89 % 10 = 9
So 3764-00-9 is a valid CAS Registry Number.
InChI:InChI=1/C6H5Cl3N2/c1-3-5(8)10-4(2-7)11-6(3)9/h2H2,1H3
