376646-63-8 Usage
Uses
Used in Organic Synthesis:
3-(3-Bromophenyl)propionitrile is used as an organic synthesis intermediate for the creation of more complex molecules. Its unique chemical behavior and reactivity make it a valuable compound in the synthesis of various organic compounds.
Used in Research Studies:
In the field of research, 3-(3-Bromophenyl)propionitrile is employed as a chemical compound for studying its properties and potential applications. Its presence in laboratory settings allows researchers to explore its reactivity and behavior in different chemical reactions.
Used in Pharmaceutical Industry:
3-(3-Bromophenyl)propionitrile is used as a building block in the development of pharmaceutical compounds. Its unique structure and reactivity make it a potential candidate for the synthesis of new drugs and therapeutic agents.
Used in Chemical Industry:
In the chemical industry, 3-(3-Bromophenyl)propionitrile is utilized as a raw material for the production of various chemical products. Its versatility in organic synthesis allows for the creation of a wide range of chemical compounds for different applications.
Safety Precautions:
Due to the potential risks associated with exposure to 3-(3-Bromophenyl)propionitrile, it should be handled with extreme care. It is essential that only trained individuals work with 3-(3-BROMOPHENYL)PROPIONITRILE, and proper safety measures should be in place to minimize the risk of exposure.
Check Digit Verification of cas no
The CAS Registry Mumber 376646-63-8 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 3,7,6,6,4 and 6 respectively; the second part has 2 digits, 6 and 3 respectively.
Calculate Digit Verification of CAS Registry Number 376646-63:
(8*3)+(7*7)+(6*6)+(5*6)+(4*4)+(3*6)+(2*6)+(1*3)=188
188 % 10 = 8
So 376646-63-8 is a valid CAS Registry Number.
InChI:InChI=1/C9H8BrN/c10-9-5-1-3-8(7-9)4-2-6-11/h1,3,5,7H,2,4H2
