37673-32-8 Usage
Chemical class
Proline derivatives
Explanation
1-octylnonyl 5-oxo-L-prolinate belongs to the class of proline derivatives, which are compounds derived from the amino acid proline.
Explanation
The compound consists of an eight-carbon octyl group and a proline derivative with a five-carbon ring and an oxo group (double-bonded oxygen) connected by a nonyl spacer (a nine-carbon chain).
Explanation
1-octylnonyl 5-oxo-L-prolinate has both hydrophilic (water-loving) and lipophilic (fat-loving) properties, which allows it to reduce the surface tension between two immiscible substances (e.g., oil and water).
Explanation
Due to its amphiphilic nature, 1-octylnonyl 5-oxo-L-prolinate can be used in various applications, such as emulsifiers (to mix oil and water), surfactants (to reduce surface tension in solutions), and pharmaceuticals (as a potential drug delivery system or stabilizing agent).
Explanation
The unique structure of 1-octylnonyl 5-oxo-L-prolinate makes it a potential candidate for use in drug delivery systems, as it can help improve the solubility and stability of drugs.
Explanation
1-octylnonyl 5-oxo-L-prolinate can act as a stabilizing agent in different formulations, helping to maintain the stability and consistency of products.
Explanation
More research is required to explore the full potential of 1-octylnonyl 5-oxo-L-prolinate and to determine its specific benefits and applications in various fields.
Composition
1-octyl group and 5-oxo-L-proline group connected by a nonyl spacer
Amphiphilic nature
Ability to lower surface tension between immiscible phases
Potential applications
Emulsifiers, surfactants, and pharmaceuticals
Drug delivery systems
Promising candidate for use in drug delivery
Stabilizing agent
Use in various formulations
Further research needed
To fully understand its potential benefits and applications
Check Digit Verification of cas no
The CAS Registry Mumber 37673-32-8 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 3,7,6,7 and 3 respectively; the second part has 2 digits, 3 and 2 respectively.
Calculate Digit Verification of CAS Registry Number 37673-32:
(7*3)+(6*7)+(5*6)+(4*7)+(3*3)+(2*3)+(1*2)=138
138 % 10 = 8
So 37673-32-8 is a valid CAS Registry Number.
InChI:InChI=1/C22H41NO3/c1-3-5-7-9-11-13-15-19(16-14-12-10-8-6-4-2)26-22(25)20-17-18-21(24)23-20/h19-20H,3-18H2,1-2H3,(H,23,24)/t20-/m0/s1