37755-50-3 Usage
Uses
Used in Pharmaceutical Production:
(R)-1-carboxy-3-methylbutyl 5-oxo-L-prolinate is employed as a key intermediate in the synthesis of pharmaceuticals. Its role in creating enantiomerically pure compounds is vital, as the purity of a drug's enantiomers can significantly impact its efficacy and safety profile. (R)-1-carboxy-3-methylbutyl 5-oxo-L-prolinate contributes to the development of life-saving medications and therapeutic agents.
Used in Agrochemical Synthesis:
In the agrochemical industry, (R)-1-carboxy-3-methylbutyl 5-oxo-L-prolinate is used as a chiral building block for the production of various agrochemicals. Its application in this field aids in the development of more effective and environmentally friendly pesticides, herbicides, and other agricultural products.
Used as a Chiral Ligand in Asymmetric Catalysis:
(R)-1-carboxy-3-methylbutyl 5-oxo-L-prolinate is also utilized as a chiral ligand in asymmetric catalysis. This application is significant in the synthesis of biologically active molecules, as it allows for the creation of compounds with specific stereochemistry, which can be crucial for their biological activity and selectivity.
Used in the Synthesis of Biologically Active Molecules:
(R)-1-carboxy-3-methylbutyl 5-oxo-L-prolinate is a valuable tool in the synthesis of biologically active molecules due to its unique stereochemistry. It is used to produce molecules with specific spatial arrangements that are essential for their interaction with biological targets, such as receptors or enzymes, leading to potential applications in drug discovery and development.
Check Digit Verification of cas no
The CAS Registry Mumber 37755-50-3 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 3,7,7,5 and 5 respectively; the second part has 2 digits, 5 and 0 respectively.
Calculate Digit Verification of CAS Registry Number 37755-50:
(7*3)+(6*7)+(5*7)+(4*5)+(3*5)+(2*5)+(1*0)=143
143 % 10 = 3
So 37755-50-3 is a valid CAS Registry Number.
InChI:InChI=1/C11H17NO5/c1-6(2)5-8(10(14)15)17-11(16)7-3-4-9(13)12-7/h6-8H,3-5H2,1-2H3,(H,12,13)(H,14,15)/t7-,8+/m0/s1
37755-50-3Relevant academic research and scientific papers
Furan, benzofuran and tetrahydrofuran carboxylic acid esters
-
, (2008/06/13)
Compounds represented by the following formula EQU1 wherein A is a substituted or unsubstituted heterocyclic radical and T is a C2 -C5 alkyl, alkenyl, cyclopropylmethyl, cyclobutylmethyl or cyclopentyl group A process for their preparation and novel intermediates therefor are disclosed. These compounds are useful antibiotics.
