3780-83-4 Usage
Uses
Used in Pharmaceutical Industry:
2-[2-(3,5-DICHLOROPHENYL)HYDRAZONO]MALONONITRILE is used as a building block for the synthesis of various pharmaceutical drugs. Its unique chemical structure allows it to be a key component in the development of new medications, contributing to the advancement of healthcare and treatment options.
Used in Agrochemical Industry:
In the agrochemical sector, 2-[2-(3,5-DICHLOROPHENYL)HYDRAZONO]MALONONITRILE serves as a fundamental component in the creation of agrochemicals. Its role in this industry is crucial for the development of effective products that protect crops and enhance agricultural productivity.
Used in Materials Science:
2-[2-(3,5-DICHLOROPHENYL)HYDRAZONO]MALONONITRILE is utilized in materials science for its potential applications in creating new materials with unique properties. Its chemical composition makes it a valuable candidate for research and development in this field.
Used as a Reagent in Organic Chemistry:
2-[2-(3,5-DICHLOROPHENYL)HYDRAZONO]MALONONITRILE also functions as a reagent in organic chemistry reactions, facilitating various chemical processes and transformations. Its versatility in this context is essential for the progression of organic chemistry research and practical applications.
Check Digit Verification of cas no
The CAS Registry Mumber 3780-83-4 includes 7 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 4 digits, 3,7,8 and 0 respectively; the second part has 2 digits, 8 and 3 respectively.
Calculate Digit Verification of CAS Registry Number 3780-83:
(6*3)+(5*7)+(4*8)+(3*0)+(2*8)+(1*3)=104
104 % 10 = 4
So 3780-83-4 is a valid CAS Registry Number.
InChI:InChI=1/C9H4Cl2N4/c10-6-1-7(11)3-8(2-6)14-15-9(4-12)5-13/h1-3,14H
3780-83-4Relevant academic research and scientific papers
Method for the determination of an ion with increased sensitivity, use of substances which are suitable for this and a corresponding agent
-
, (2008/06/13)
The invention relates to a method for determining an ion in an aqueous sample. The method involves contacting the sample with a water immiscible material including an ionophore, a pH indicator and a compound which stabilizes sensitivity of the assay. The
