378223-36-0 Usage
Uses
Used in Medicinal Chemistry:
3-Benzyl-2-oxazolidinecarboxylic acid is used as a key intermediate in the synthesis of pharmaceuticals for its unique chemical structure and properties. It contributes to the development of new drugs with enhanced therapeutic effects and reduced side effects.
Used in Drug Development:
In the pharmaceutical industry, 3-Benzyl-2-oxazolidinecarboxylic acid is utilized as a precursor for the creation of novel bioactive compounds. Its potential to exhibit interesting biological activities makes it a valuable asset in the discovery and development of innovative medications to address unmet medical needs.
Used in Synthesis of Bioactive Compounds:
3-Benzyl-2-oxazolidinecarboxylic acid serves as a versatile building block in the synthesis of a wide range of bioactive compounds. Its unique structure allows for the creation of new molecules with potential applications in various therapeutic areas, including but not limited to, antibacterial, antiviral, and anticancer agents.
Check Digit Verification of cas no
The CAS Registry Mumber 378223-36-0 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 3,7,8,2,2 and 3 respectively; the second part has 2 digits, 3 and 6 respectively.
Calculate Digit Verification of CAS Registry Number 378223-36:
(8*3)+(7*7)+(6*8)+(5*2)+(4*2)+(3*3)+(2*3)+(1*6)=160
160 % 10 = 0
So 378223-36-0 is a valid CAS Registry Number.
InChI:InChI=1/C11H13NO3/c13-11(14)10-12(6-7-15-10)8-9-4-2-1-3-5-9/h1-5,10H,6-8H2,(H,13,14)
