3789-97-7 Usage
Uses
Used in Pharmaceutical Synthesis:
D-Glucuronamide is used as a key component in the synthesis of various pharmaceuticals for its versatile chemical properties and potential therapeutic effects.
Used in Biochemical Research:
In the field of biochemical research, D-Glucuronamide serves as a valuable reagent, facilitating studies on biological processes and the development of new therapeutic agents.
Used in Anti-Inflammatory Applications:
D-Glucuronamide is used as an anti-inflammatory agent, leveraging its potential to modulate inflammatory responses and alleviate symptoms associated with inflammation.
Used in Anti-Cancer Applications:
As an anti-cancer agent, D-Glucuronamide is utilized for its potential to target and inhibit cancer cell growth, making it a promising candidate for cancer treatment and prevention.
Used in Detoxification Processes:
D-Glucuronamide plays a crucial role in detoxification processes within the body, aiding in the removal of harmful substances and supporting overall health and well-being.
Used in Industrial Applications:
In industrial settings, D-Glucuronamide is employed for its diverse applications, including the development of new materials and processes that benefit from its unique chemical properties.
Check Digit Verification of cas no
The CAS Registry Mumber 3789-97-7 includes 7 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 4 digits, 3,7,8 and 9 respectively; the second part has 2 digits, 9 and 7 respectively.
Calculate Digit Verification of CAS Registry Number 3789-97:
(6*3)+(5*7)+(4*8)+(3*9)+(2*9)+(1*7)=137
137 % 10 = 7
So 3789-97-7 is a valid CAS Registry Number.
InChI:InChI=1/C6H11NO6/c7-6(13)5(12)4(11)3(10)2(9)1-8/h1-5,9-12H,(H2,7,13)/t2-,3+,4-,5-/m0/s1
