37895-24-2 Usage
Uses
Used in Pharmaceutical Research:
7-Methoxy-1,3-benzoxazine-2,4-dione is used as a key intermediate in the synthesis of various pharmaceutical compounds for its potential therapeutic applications. Its unique chemical structure allows for the development of new drugs with improved efficacy and reduced side effects.
Used in Anti-Cancer Medications:
In the field of oncology, 7-Methoxy-1,3-benzoxazine-2,4-dione is used as a potential anti-cancer agent. Its ability to interact with cellular targets and inhibit cancer cell growth makes it a promising candidate for the development of novel cancer therapies.
Used in Anti-Inflammatory Medications:
7-Methoxy-1,3-benzoxazine-2,4-dione is also used as a potential anti-inflammatory agent. Its capacity to modulate inflammatory pathways and reduce inflammation-related symptoms positions it as a candidate for the treatment of various inflammatory disorders.
Used in Organic Synthesis:
7-Methoxy-1,3-benzoxazine-2,4-dione is utilized as a versatile building block in organic synthesis. Its reactivity and ability to undergo various chemical reactions enable the creation of a wide range of chemical compounds for diverse applications.
Used in Scientific Exploration and Development:
Due to its unique chemical properties, 7-Methoxy-1,3-benzoxazine-2,4-dione is employed in scientific research to explore new chemical reactions and develop innovative applications. Its potential for further exploration makes it an essential compound in advancing the field of chemistry and related disciplines.
Check Digit Verification of cas no
The CAS Registry Mumber 37895-24-2 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 3,7,8,9 and 5 respectively; the second part has 2 digits, 2 and 4 respectively.
Calculate Digit Verification of CAS Registry Number 37895-24:
(7*3)+(6*7)+(5*8)+(4*9)+(3*5)+(2*2)+(1*4)=162
162 % 10 = 2
So 37895-24-2 is a valid CAS Registry Number.
InChI:InChI=1/C9H7NO4/c1-13-5-2-3-6-7(4-5)14-9(12)10-8(6)11/h2-4H,1H3,(H,10,11,12)
37895-24-2Relevant academic research and scientific papers
A novel strategy for the synthesis of uracil derivatives using bis(pentafluorophenyl)imidodicarbonate
Chichetti, Stephanie M.,Ahearn, Sean P.,Rivkin, Alexey
scheme or table, p. 6081 - 6083 (2009/04/04)
The disclosure herein describes a novel strategy for the synthesis of uracil derivatives via a solvent-free microwave cyclocondensation reaction using bis(pentafluorophenyl)imidodicarbonate.
