37898-32-1 Usage
Description
4-Phenyl-5-methyl-6-hydroxypyrimidine is a heterocyclic organic compound with the molecular formula C11H11N3O. It belongs to the pyrimidine class of compounds, characterized by a six-membered ring with four carbon atoms and two nitrogen atoms. This derivative features a phenyl group, a methyl group, and a hydroxyl functional group, which contribute to its potential biological activity and applications in the pharmaceutical industry.
Uses
Used in Pharmaceutical Industry:
4-Phenyl-5-methyl-6-hydroxypyrimidine is used as a chemical intermediate for the synthesis of various drugs and medicinal compounds due to its unique structure and potential biological activity.
Used in Organic Chemistry Research:
4-Phenyl-5-methyl-6-hydroxypyrimidine serves as a subject of interest for researchers and chemists in the field of organic chemistry, as its properties and potential applications contribute to the advancement of drug discovery and development.
Check Digit Verification of cas no
The CAS Registry Mumber 37898-32-1 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 3,7,8,9 and 8 respectively; the second part has 2 digits, 3 and 2 respectively.
Calculate Digit Verification of CAS Registry Number 37898-32:
(7*3)+(6*7)+(5*8)+(4*9)+(3*8)+(2*3)+(1*2)=171
171 % 10 = 1
So 37898-32-1 is a valid CAS Registry Number.
InChI:InChI=1/C11H10N2O/c1-8-10(12-7-13-11(8)14)9-5-3-2-4-6-9/h2-7H,1H3,(H,12,13,14)
