3790-04-3 Usage
Molecular structure
Contains a cyanoethyl group (a propene nitrile group), a carbamate group (an amide of carbonic acid), and a 3-chlorophenyl group (a chlorinated aromatic ring).
Usage
Utilized in the synthesis of various organic molecules and pharmaceuticals.
Chemical properties
Has the potential to exhibit a range of chemical properties, such as reactivity, solubility, and stability, depending on the specific conditions and reagents it is exposed to.
Biological properties
May have potential biological activity, including toxicity, mutagenicity, or carcinogenicity, and should be handled with care to avoid harm to humans and animals.
Environmental impact
It is important to consider the potential environmental effects of 1-cyanoethyl N-(3-chlorophenyl)carbamate and to handle and dispose of it responsibly to minimize any negative effects on the environment.
Check Digit Verification of cas no
The CAS Registry Mumber 3790-04-3 includes 7 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 4 digits, 3,7,9 and 0 respectively; the second part has 2 digits, 0 and 4 respectively.
Calculate Digit Verification of CAS Registry Number 3790-04:
(6*3)+(5*7)+(4*9)+(3*0)+(2*0)+(1*4)=93
93 % 10 = 3
So 3790-04-3 is a valid CAS Registry Number.
InChI:InChI=1/C10H9ClN2O2/c1-7(6-12)15-10(14)13-9-4-2-3-8(11)5-9/h2-5,7H,1H3,(H,13,14)
