37959-19-6 Usage
Description
(5-OXO-1-PYRIDIN-2-YL-2,5-DIHYDRO-1H-PYRAZOL-3-YL)ACETIC ACID, also known as PIDPA, is a pyridine derivative with a molecular formula of C12H11N3O3. It possesses potential anti-inflammatory and analgesic properties and has been studied for its potential use in treating various inflammatory conditions, including rheumatoid arthritis and other autoimmune diseases. Its mechanism of action involves inhibiting the production of pro-inflammatory mediators, such as prostaglandins and leukotrienes, by blocking the enzyme cyclooxygenase.
Used in Pharmaceutical Industry:
PIDPA is used as a potential drug candidate for inflammation-related diseases due to its anti-inflammatory and analgesic properties. It inhibits the production of pro-inflammatory mediators by blocking the enzyme cyclooxygenase, making it a promising option for treating conditions such as rheumatoid arthritis and other autoimmune diseases.
While further research is needed to fully understand its therapeutic potential, PIDPA shows promise as a potential drug candidate for inflammation-related diseases.
Check Digit Verification of cas no
The CAS Registry Mumber 37959-19-6 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 3,7,9,5 and 9 respectively; the second part has 2 digits, 1 and 9 respectively.
Calculate Digit Verification of CAS Registry Number 37959-19:
(7*3)+(6*7)+(5*9)+(4*5)+(3*9)+(2*1)+(1*9)=166
166 % 10 = 6
So 37959-19-6 is a valid CAS Registry Number.
InChI:InChI=1/C10H9N3O3/c14-9-5-7(6-10(15)16)12-13(9)8-3-1-2-4-11-8/h1-5,12H,6H2,(H,15,16)