37959-37-8 Usage
Explanation
Different sources of media describe the Explanation of 37959-37-8 differently. You can refer to the following data:
1. The molecular formula represents the number of atoms of each element present in a molecule. In this case, the compound has 15 carbon (C) atoms, 16 hydrogen (H) atoms, and 2 nitrogen (N) atoms.
2. Heterocyclic compound
2. A heterocyclic compound is a cyclic compound that contains atoms of at least two different elements as part of its ring structure. In this case, the compound contains a pyrrole ring fused to an imidazole ring.
3. The imidazole ring is another common structural motif in organic chemistry, often found in biologically active compounds. Its presence in the molecule contributes to its potential pharmaceutical applications.
5. Fused rings
4. The pyrrole and imidazole rings are fused, meaning they share two adjacent atoms, forming a single, larger ring system. This fusion of rings is a key feature of the compound's structure.
6. 1-Ethyl substitution
5. The compound has an ethyl group (-CH2CH3) attached to the first carbon atom of the pyrrole ring. This substitution can influence the compound's reactivity, solubility, and other properties.
7. p-Tolyl substitution
6. The compound has a para-tolyl group (-C6H4-CH3) attached to the sixth carbon atom of the imidazole ring. This substitution can affect the compound's steric and electronic properties, as well as its potential biological activity.
7. Synonyms are alternative names for a compound, which can be useful for searching in scientific literature or databases.
9. Research and development
8. The compound is used in research and development, likely due to its unique structure and potential applications in various fields.
10. Chemical synthesis
9. The compound is used as a building block in the synthesis of other organic compounds, taking advantage of its reactive functional groups and structural features.
11. Potential pharmaceutical applications
10. The compound is being studied for its biological activity and potential therapeutic uses, suggesting that it may have properties that could be useful in the development of new drugs.
12. Biological activity
11. The compound's biological activity refers to its ability to interact with biological systems, such as enzymes, receptors, or other cellular targets. This activity is a key factor in determining its potential pharmaceutical applications.
13. Therapeutic uses
12. The compound is being investigated for its potential therapeutic uses, which could include the treatment of various diseases or conditions. The specific therapeutic applications would depend on the results of further research and development.
Pyrrole ring
a five-membered ring with four carbon atoms and one nitrogen atom
Imidazole ring
a five-membered ring with three carbon atoms and two nitrogen atoms
Synonyms
Ethyl p-tolylimidazo[1,2-a]pyrrole
Check Digit Verification of cas no
The CAS Registry Mumber 37959-37-8 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 3,7,9,5 and 9 respectively; the second part has 2 digits, 3 and 7 respectively.
Calculate Digit Verification of CAS Registry Number 37959-37:
(7*3)+(6*7)+(5*9)+(4*5)+(3*9)+(2*3)+(1*7)=168
168 % 10 = 8
So 37959-37-8 is a valid CAS Registry Number.
InChI:InChI=1/C15H16N2/c1-3-16-8-9-17-11-14(10-15(16)17)13-6-4-12(2)5-7-13/h4-11H,3H2,1-2H3
