37959-38-9 Usage
Chemical compound
1,6-Diphenyl-1H-pyrrolo(1,2-a)imidazole
Explanation
Different sources of media describe the Explanation of 37959-38-9 differently. You can refer to the following data:
1. This is the specific name given to the compound, which is derived from its structure and composition.
2. The compound is classified as an organic heterocyclic compound because it contains a ring structure made up of carbon and nitrogen atoms, with nitrogen being the heteroatom.
3. Due to its unique structure and properties, 1,6-Diphenyl-1H-pyrrolo(1,2-a)imidazole may be useful in the development of new drugs and pharmaceuticals.
4. The compound's unique structure and properties make it a versatile compound with a wide range of potential applications in different fields, including but not limited to chemistry.
Organic heterocyclic compound
Unique ring structure
Potential applications
Pharmaceuticals, drug development
Additional applications
Materials science, organic chemistry research
Versatility
Various potential applications in chemistry and beyond
Check Digit Verification of cas no
The CAS Registry Mumber 37959-38-9 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 3,7,9,5 and 9 respectively; the second part has 2 digits, 3 and 8 respectively.
Calculate Digit Verification of CAS Registry Number 37959-38:
(7*3)+(6*7)+(5*9)+(4*5)+(3*9)+(2*3)+(1*8)=169
169 % 10 = 9
So 37959-38-9 is a valid CAS Registry Number.
InChI:InChI=1/C18H14N2/c1-3-7-15(8-4-1)16-13-18-19(14-16)11-12-20(18)17-9-5-2-6-10-17/h1-14H
